C12H20N2 — CID 115226858
N-methyl-N'-[(2,4,5-trimethylphenyl)methyl]methanediamine (PubChem CID 115226858) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is N-methyl-N'-[(2,4,5-trimethylphenyl)methyl]methanediamine.
| Compound Name | N-methyl-N'-[(2,4,5-trimethylphenyl)methyl]methanediamine |
|---|---|
| PubChem CID | 115226858 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | N-methyl-N'-[(2,4,5-trimethylphenyl)methyl]methanediamine |
| SMILES | CNCNCc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C12H20N2/c1-9-5-11(3)12(6-10(9)2)7-14-8-13-4/h5-6,13-14H,7-8H2,1-4H3 |
| InChIKey | ANMJOPDNMZXBNE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|