C12H18Br2N2O — CID 107740697
2,6-dibromo-4-[[2-(dimethylamino)propylamino]methyl]phenol (PubChem CID 107740697) has the molecular formula C12H18Br2N2O and a molecular weight of 366.10 g/mol. Its IUPAC name is 2,6-dibromo-4-[[2-(dimethylamino)propylamino]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[2-(dimethylamino)propylamino]methyl]phenol |
|---|---|
| PubChem CID | 107740697 |
| Molecular Formula | C12H18Br2N2O |
| Molecular Weight | 366.10 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 2,6-dibromo-4-[[2-(dimethylamino)propylamino]methyl]phenol |
| SMILES | CC(CNCc1cc(Br)c(O)c(Br)c1)N(C)C |
| InChI | InChI=1S/C12H18Br2N2O/c1-8(16(2)3)6-15-7-9-4-10(13)12(17)11(14)5-9/h4-5,8,15,17H,6-7H2,1-3H3 |
| InChIKey | XPSGUDGPBBENEO-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.10 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |