C12H17Br2NO — CID 107740214
2,6-dibromo-4-[[butan-2-yl(methyl)amino]methyl]phenol (PubChem CID 107740214) has the molecular formula C12H17Br2NO and a molecular weight of 351.08 g/mol. Its IUPAC name is 2,6-dibromo-4-[[butan-2-yl(methyl)amino]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[butan-2-yl(methyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 107740214 |
| Molecular Formula | C12H17Br2NO |
| Molecular Weight | 351.08 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | 2,6-dibromo-4-[[butan-2-yl(methyl)amino]methyl]phenol |
| SMILES | CCC(C)N(C)Cc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C12H17Br2NO/c1-4-8(2)15(3)7-9-5-10(13)12(16)11(14)6-9/h5-6,8,16H,4,7H2,1-3H3 |
| InChIKey | HRCNYMOYLNQLRT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.08 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |