C13H19Br2NO — CID 107740831
2,6-dibromo-4-[(2,3-dimethylbutylamino)methyl]phenol (PubChem CID 107740831) has the molecular formula C13H19Br2NO and a molecular weight of 365.11 g/mol. Its IUPAC name is 2,6-dibromo-4-[(2,3-dimethylbutylamino)methyl]phenol.
| Compound Name | 2,6-dibromo-4-[(2,3-dimethylbutylamino)methyl]phenol |
|---|---|
| PubChem CID | 107740831 |
| Molecular Formula | C13H19Br2NO |
| Molecular Weight | 365.11 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | 2,6-dibromo-4-[(2,3-dimethylbutylamino)methyl]phenol |
| SMILES | CC(C)C(C)CNCc1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C13H19Br2NO/c1-8(2)9(3)6-16-7-10-4-11(14)13(17)12(15)5-10/h4-5,8-9,16-17H,6-7H2,1-3H3 |
| InChIKey | USRXFCKMJNAWAC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.11 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |