C14H12Br3NO — CID 107740485
2,6-dibromo-4-[[(4-bromophenyl)methylamino]methyl]phenol (PubChem CID 107740485) has the molecular formula C14H12Br3NO and a molecular weight of 449.97 g/mol. Its IUPAC name is 2,6-dibromo-4-[[(4-bromophenyl)methylamino]methyl]phenol.
| Compound Name | 2,6-dibromo-4-[[(4-bromophenyl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 107740485 |
| Molecular Formula | C14H12Br3NO |
| Molecular Weight | 449.97 g/mol |
| Exact Mass | 446.85 |
| IUPAC Name | 2,6-dibromo-4-[[(4-bromophenyl)methylamino]methyl]phenol |
| SMILES | Oc1c(Br)cc(CNCc2ccc(Br)cc2)cc1Br |
| InChI | InChI=1S/C14H12Br3NO/c15-11-3-1-9(2-4-11)7-18-8-10-5-12(16)14(19)13(17)6-10/h1-6,18-19H,7-8H2 |
| InChIKey | RDPOGAUTSCXKQG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.97 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |