C9H12O4 — CID 141358903
5-(2-hydroxypropyl)benzene-1,2,3-triol (PubChem CID 141358903) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 5-(2-hydroxypropyl)benzene-1,2,3-triol.
| Compound Name | 5-(2-hydroxypropyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 141358903 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 5-(2-hydroxypropyl)benzene-1,2,3-triol |
| SMILES | CC(O)Cc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C9H12O4/c1-5(10)2-6-3-7(11)9(13)8(12)4-6/h3-5,10-13H,2H2,1H3 |
| InChIKey | BDBBJJDUCJRVHE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|