C10H10F2O2 — CID 87217406
2,6-difluoro-4-(2-hydroxypropyl)benzaldehyde (PubChem CID 87217406) has the molecular formula C10H10F2O2 and a molecular weight of 200.18 g/mol. Its IUPAC name is 2,6-difluoro-4-(2-hydroxypropyl)benzaldehyde.
| Compound Name | 2,6-difluoro-4-(2-hydroxypropyl)benzaldehyde |
|---|---|
| PubChem CID | 87217406 |
| Molecular Formula | C10H10F2O2 |
| Molecular Weight | 200.18 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2,6-difluoro-4-(2-hydroxypropyl)benzaldehyde |
| SMILES | CC(O)Cc1cc(F)c(C=O)c(F)c1 |
| InChI | InChI=1S/C10H10F2O2/c1-6(14)2-7-3-9(11)8(5-13)10(12)4-7/h3-6,14H,2H2,1H3 |
| InChIKey | JCKHDTRKTCDYAS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|