C11H14F2O2 — CID 117307929
1-[3,5-difluoro-4-(methoxymethyl)phenyl]propan-2-ol (PubChem CID 117307929) has the molecular formula C11H14F2O2 and a molecular weight of 216.23 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-(methoxymethyl)phenyl]propan-2-ol.
| Compound Name | 1-[3,5-difluoro-4-(methoxymethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 117307929 |
| Molecular Formula | C11H14F2O2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 1-[3,5-difluoro-4-(methoxymethyl)phenyl]propan-2-ol |
| SMILES | COCc1c(F)cc(CC(C)O)cc1F |
| InChI | InChI=1S/C11H14F2O2/c1-7(14)3-8-4-10(12)9(6-15-2)11(13)5-8/h4-5,7,14H,3,6H2,1-2H3 |
| InChIKey | LLEGDMKUFJREIQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |