C11H15FO2 — CID 117287870
1-[3-fluoro-4-(methoxymethyl)phenyl]propan-2-ol (PubChem CID 117287870) has the molecular formula C11H15FO2 and a molecular weight of 198.24 g/mol. Its IUPAC name is 1-[3-fluoro-4-(methoxymethyl)phenyl]propan-2-ol.
| Compound Name | 1-[3-fluoro-4-(methoxymethyl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 117287870 |
| Molecular Formula | C11H15FO2 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 1-[3-fluoro-4-(methoxymethyl)phenyl]propan-2-ol |
| SMILES | COCc1ccc(CC(C)O)cc1F |
| InChI | InChI=1S/C11H15FO2/c1-8(13)5-9-3-4-10(7-14-2)11(12)6-9/h3-4,6,8,13H,5,7H2,1-2H3 |
| InChIKey | RKSYCWJQGXRLBP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |