C11H16FN — CID 63887126
[2-fluoro-4-(2-methylpropyl)phenyl]methanamine (PubChem CID 63887126) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is [2-fluoro-4-(2-methylpropyl)phenyl]methanamine.
| Compound Name | [2-fluoro-4-(2-methylpropyl)phenyl]methanamine |
|---|---|
| PubChem CID | 63887126 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | [2-fluoro-4-(2-methylpropyl)phenyl]methanamine |
| SMILES | CC(C)Cc1ccc(CN)c(F)c1 |
| InChI | InChI=1S/C11H16FN/c1-8(2)5-9-3-4-10(7-13)11(12)6-9/h3-4,6,8H,5,7,13H2,1-2H3 |
| InChIKey | KJADAXYRRBHTKY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |