C12H17F3 — CID 145128003
ethane;1,2,3-trifluoro-5-(2-methylpropyl)benzene (PubChem CID 145128003) has the molecular formula C12H17F3 and a molecular weight of 218.26 g/mol. Its IUPAC name is ethane;1,2,3-trifluoro-5-(2-methylpropyl)benzene.
| Compound Name | ethane;1,2,3-trifluoro-5-(2-methylpropyl)benzene |
|---|---|
| PubChem CID | 145128003 |
| Molecular Formula | C12H17F3 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | ethane;1,2,3-trifluoro-5-(2-methylpropyl)benzene |
| SMILES | CC.CC(C)Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H11F3.C2H6/c1-6(2)3-7-4-8(11)10(13)9(12)5-7;1-2/h4-6H,3H2,1-2H3;1-2H3 |
| InChIKey | WBERCKATBQZSHH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|