C8H6BrF3 — CID 22913642
5-(2-bromoethyl)-1,2,3-trifluorobenzene (PubChem CID 22913642) has the molecular formula C8H6BrF3 and a molecular weight of 239.03 g/mol. Its IUPAC name is 5-(2-bromoethyl)-1,2,3-trifluorobenzene.
| Compound Name | 5-(2-bromoethyl)-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 22913642 |
| Molecular Formula | C8H6BrF3 |
| Molecular Weight | 239.03 g/mol |
| Exact Mass | 237.96 |
| IUPAC Name | 5-(2-bromoethyl)-1,2,3-trifluorobenzene |
| SMILES | Fc1cc(CCBr)cc(F)c1F |
| InChI | InChI=1S/C8H6BrF3/c9-2-1-5-3-6(10)8(12)7(11)4-5/h3-4H,1-2H2 |
| InChIKey | LPIPCUJEZWXEED-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.03 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|