C7H6F3NS — CID 155699615
N-[(3,4,5-trifluorophenyl)methyl]thiohydroxylamine (PubChem CID 155699615) has the molecular formula C7H6F3NS and a molecular weight of 193.19 g/mol. Its IUPAC name is N-[(3,4,5-trifluorophenyl)methyl]thiohydroxylamine.
| Compound Name | N-[(3,4,5-trifluorophenyl)methyl]thiohydroxylamine |
|---|---|
| PubChem CID | 155699615 |
| Molecular Formula | C7H6F3NS |
| Molecular Weight | 193.19 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | N-[(3,4,5-trifluorophenyl)methyl]thiohydroxylamine |
| SMILES | Fc1cc(CNS)cc(F)c1F |
| InChI | InChI=1S/C7H6F3NS/c8-5-1-4(3-11-12)2-6(9)7(5)10/h1-2,11-12H,3H2 |
| InChIKey | SAJCPGMXAAVBHX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|