C9H10F3N — CID 64866186
N-methyl-2-(3,4,5-trifluorophenyl)ethanamine (PubChem CID 64866186) has the molecular formula C9H10F3N and a molecular weight of 189.18 g/mol. Its IUPAC name is N-methyl-2-(3,4,5-trifluorophenyl)ethanamine.
| Compound Name | N-methyl-2-(3,4,5-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 64866186 |
| Molecular Formula | C9H10F3N |
| Molecular Weight | 189.18 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | N-methyl-2-(3,4,5-trifluorophenyl)ethanamine |
| SMILES | CNCCc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C9H10F3N/c1-13-3-2-6-4-7(10)9(12)8(11)5-6/h4-5,13H,2-3H2,1H3 |
| InChIKey | DNWVIRRPOWDQNU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|