C9H10F3NO — CID 117293116
2,4,5-trifluoro-3-[2-(methylamino)ethyl]phenol (PubChem CID 117293116) has the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. Its IUPAC name is 2,4,5-trifluoro-3-[2-(methylamino)ethyl]phenol.
| Compound Name | 2,4,5-trifluoro-3-[2-(methylamino)ethyl]phenol |
|---|---|
| PubChem CID | 117293116 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2,4,5-trifluoro-3-[2-(methylamino)ethyl]phenol |
| SMILES | CNCCc1c(F)c(O)cc(F)c1F |
| InChI | InChI=1S/C9H10F3NO/c1-13-3-2-5-8(11)6(10)4-7(14)9(5)12/h4,13-14H,2-3H2,1H3 |
| InChIKey | JVJNRQSEMWTYTH-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|