C8H8F3NO2 — CID 117295383
3-(2-aminooxyethyl)-2,4,5-trifluorophenol (PubChem CID 117295383) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is 3-(2-aminooxyethyl)-2,4,5-trifluorophenol.
| Compound Name | 3-(2-aminooxyethyl)-2,4,5-trifluorophenol |
|---|---|
| PubChem CID | 117295383 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 3-(2-aminooxyethyl)-2,4,5-trifluorophenol |
| SMILES | NOCCc1c(F)c(O)cc(F)c1F |
| InChI | InChI=1S/C8H8F3NO2/c9-5-3-6(13)8(11)4(7(5)10)1-2-14-12/h3,13H,1-2,12H2 |
| InChIKey | LZUKTYXVQLZEFQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|