C10H11F2NO3 — CID 117333559
methyl 5-(2-aminooxyethyl)-2,3-difluorobenzoate (PubChem CID 117333559) has the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. Its IUPAC name is methyl 5-(2-aminooxyethyl)-2,3-difluorobenzoate.
| Compound Name | methyl 5-(2-aminooxyethyl)-2,3-difluorobenzoate |
|---|---|
| PubChem CID | 117333559 |
| Molecular Formula | C10H11F2NO3 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | methyl 5-(2-aminooxyethyl)-2,3-difluorobenzoate |
| SMILES | COC(=O)c1cc(CCON)cc(F)c1F |
| InChI | InChI=1S/C10H11F2NO3/c1-15-10(14)7-4-6(2-3-16-13)5-8(11)9(7)12/h4-5H,2-3,13H2,1H3 |
| InChIKey | UBJFVTDQUDTYJG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|