C8H10FNO3 — CID 117280609
5-(2-aminooxyethyl)-3-fluorobenzene-1,2-diol (PubChem CID 117280609) has the molecular formula C8H10FNO3 and a molecular weight of 187.17 g/mol. Its IUPAC name is 5-(2-aminooxyethyl)-3-fluorobenzene-1,2-diol.
| Compound Name | 5-(2-aminooxyethyl)-3-fluorobenzene-1,2-diol |
|---|---|
| PubChem CID | 117280609 |
| Molecular Formula | C8H10FNO3 |
| Molecular Weight | 187.17 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 5-(2-aminooxyethyl)-3-fluorobenzene-1,2-diol |
| SMILES | NOCCc1cc(O)c(O)c(F)c1 |
| InChI | InChI=1S/C8H10FNO3/c9-6-3-5(1-2-13-10)4-7(11)8(6)12/h3-4,11-12H,1-2,10H2 |
| InChIKey | SIUAOOPAVBGQFT-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|