C10H13ClFNO — CID 117310349
O-[2-(2-chloro-3-fluoro-5,6-dimethylphenyl)ethyl]hydroxylamine (PubChem CID 117310349) has the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. Its IUPAC name is O-[2-(2-chloro-3-fluoro-5,6-dimethylphenyl)ethyl]hydroxylamine.
| Compound Name | O-[2-(2-chloro-3-fluoro-5,6-dimethylphenyl)ethyl]hydroxylamine |
|---|---|
| PubChem CID | 117310349 |
| Molecular Formula | C10H13ClFNO |
| Molecular Weight | 217.67 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | O-[2-(2-chloro-3-fluoro-5,6-dimethylphenyl)ethyl]hydroxylamine |
| SMILES | Cc1cc(F)c(Cl)c(CCON)c1C |
| InChI | InChI=1S/C10H13ClFNO/c1-6-5-9(12)10(11)8(7(6)2)3-4-14-13/h5H,3-4,13H2,1-2H3 |
| InChIKey | DCGPCGYNYQNPHS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|