C10H14BrNO2 — CID 117403959
2-(2-aminooxyethyl)-6-bromo-3,4-dimethylphenol (PubChem CID 117403959) has the molecular formula C10H14BrNO2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 2-(2-aminooxyethyl)-6-bromo-3,4-dimethylphenol.
| Compound Name | 2-(2-aminooxyethyl)-6-bromo-3,4-dimethylphenol |
|---|---|
| PubChem CID | 117403959 |
| Molecular Formula | C10H14BrNO2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 2-(2-aminooxyethyl)-6-bromo-3,4-dimethylphenol |
| SMILES | Cc1cc(Br)c(O)c(CCON)c1C |
| InChI | InChI=1S/C10H14BrNO2/c1-6-5-9(11)10(13)8(7(6)2)3-4-14-12/h5,13H,3-4,12H2,1-2H3 |
| InChIKey | OANUFBHBDXTCAC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|