C10H10BrNO2 — CID 117393211
6-bromo-2-(isocyanatomethyl)-3,4-dimethylphenol (PubChem CID 117393211) has the molecular formula C10H10BrNO2 and a molecular weight of 256.10 g/mol. Its IUPAC name is 6-bromo-2-(isocyanatomethyl)-3,4-dimethylphenol.
| Compound Name | 6-bromo-2-(isocyanatomethyl)-3,4-dimethylphenol |
|---|---|
| PubChem CID | 117393211 |
| Molecular Formula | C10H10BrNO2 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 254.99 |
| IUPAC Name | 6-bromo-2-(isocyanatomethyl)-3,4-dimethylphenol |
| SMILES | Cc1cc(Br)c(O)c(CN=C=O)c1C |
| InChI | InChI=1S/C10H10BrNO2/c1-6-3-9(11)10(14)8(7(6)2)4-12-5-13/h3,14H,4H2,1-2H3 |
| InChIKey | DJABSWDEWAOOPA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|