C12H12BrNO — CID 117419064
5-bromo-7-(isocyanatomethyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 117419064) has the molecular formula C12H12BrNO and a molecular weight of 266.14 g/mol. Its IUPAC name is 5-bromo-7-(isocyanatomethyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-bromo-7-(isocyanatomethyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 117419064 |
| Molecular Formula | C12H12BrNO |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 5-bromo-7-(isocyanatomethyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | O=C=NCc1cc(Br)c2c(c1)CCCC2 |
| InChI | InChI=1S/C12H12BrNO/c13-12-6-9(7-14-8-15)5-10-3-1-2-4-11(10)12/h5-6H,1-4,7H2 |
| InChIKey | CUYNMRRSILVLDE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|