C15H22BrNS — CID 135256514
1-(4-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)-N-tert-butylsulfanylmethanamine (PubChem CID 135256514) has the molecular formula C15H22BrNS and a molecular weight of 328.32 g/mol. Its IUPAC name is 1-(4-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)-N-tert-butylsulfanylmethanamine.
| Compound Name | 1-(4-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)-N-tert-butylsulfanylmethanamine |
|---|---|
| PubChem CID | 135256514 |
| Molecular Formula | C15H22BrNS |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 1-(4-bromo-5,6,7,8-tetrahydronaphthalen-2-yl)-N-tert-butylsulfanylmethanamine |
| SMILES | CC(C)(C)SNCc1cc(Br)c2c(c1)CCCC2 |
| InChI | InChI=1S/C15H22BrNS/c1-15(2,3)18-17-10-11-8-12-6-4-5-7-13(12)14(16)9-11/h8-9,17H,4-7,10H2,1-3H3 |
| InChIKey | UQUIJCZSAGYJDZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|