C11H12BrNO4 — CID 117486065
1-bromo-3-(isocyanatomethyl)-2,4,5-trimethoxybenzene (PubChem CID 117486065) has the molecular formula C11H12BrNO4 and a molecular weight of 302.12 g/mol. Its IUPAC name is 1-bromo-3-(isocyanatomethyl)-2,4,5-trimethoxybenzene.
| Compound Name | 1-bromo-3-(isocyanatomethyl)-2,4,5-trimethoxybenzene |
|---|---|
| PubChem CID | 117486065 |
| Molecular Formula | C11H12BrNO4 |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 1-bromo-3-(isocyanatomethyl)-2,4,5-trimethoxybenzene |
| SMILES | COc1cc(Br)c(OC)c(CN=C=O)c1OC |
| InChI | InChI=1S/C11H12BrNO4/c1-15-9-4-8(12)10(16-2)7(5-13-6-14)11(9)17-3/h4H,5H2,1-3H3 |
| InChIKey | NHXNZZWXZBSANJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|