C10H10ClNO4 — CID 117361033
6-chloro-2-(isocyanatomethyl)-3,4-dimethoxyphenol (PubChem CID 117361033) has the molecular formula C10H10ClNO4 and a molecular weight of 243.65 g/mol. Its IUPAC name is 6-chloro-2-(isocyanatomethyl)-3,4-dimethoxyphenol.
| Compound Name | 6-chloro-2-(isocyanatomethyl)-3,4-dimethoxyphenol |
|---|---|
| PubChem CID | 117361033 |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 6-chloro-2-(isocyanatomethyl)-3,4-dimethoxyphenol |
| SMILES | COc1cc(Cl)c(O)c(CN=C=O)c1OC |
| InChI | InChI=1S/C10H10ClNO4/c1-15-8-3-7(11)9(14)6(4-12-5-13)10(8)16-2/h3,14H,4H2,1-2H3 |
| InChIKey | UQEJXOWTICCKRA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|