C11H16BrNO4 — CID 117491265
1-(3-bromo-2,5,6-trimethoxyphenyl)-N-methoxymethanamine (PubChem CID 117491265) has the molecular formula C11H16BrNO4 and a molecular weight of 306.16 g/mol. Its IUPAC name is 1-(3-bromo-2,5,6-trimethoxyphenyl)-N-methoxymethanamine.
| Compound Name | 1-(3-bromo-2,5,6-trimethoxyphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117491265 |
| Molecular Formula | C11H16BrNO4 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 1-(3-bromo-2,5,6-trimethoxyphenyl)-N-methoxymethanamine |
| SMILES | CONCc1c(OC)c(Br)cc(OC)c1OC |
| InChI | InChI=1S/C11H16BrNO4/c1-14-9-5-8(12)10(15-2)7(6-13-17-4)11(9)16-3/h5,13H,6H2,1-4H3 |
| InChIKey | UXEZKTHVMHLNBZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|