C10H14BrNO3 — CID 117441818
1-(4-bromo-2,3-dimethoxyphenyl)-N-methoxymethanamine (PubChem CID 117441818) has the molecular formula C10H14BrNO3 and a molecular weight of 276.13 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dimethoxyphenyl)-N-methoxymethanamine.
| Compound Name | 1-(4-bromo-2,3-dimethoxyphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117441818 |
| Molecular Formula | C10H14BrNO3 |
| Molecular Weight | 276.13 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 1-(4-bromo-2,3-dimethoxyphenyl)-N-methoxymethanamine |
| SMILES | CONCc1ccc(Br)c(OC)c1OC |
| InChI | InChI=1S/C10H14BrNO3/c1-13-9-7(6-12-15-3)4-5-8(11)10(9)14-2/h4-5,12H,6H2,1-3H3 |
| InChIKey | HHZBUNDHEXCHHR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.13 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|