C11H17NO5S — CID 117440327
1-(2,3-dimethoxy-4-methylsulfonylphenyl)-N-methoxymethanamine (PubChem CID 117440327) has the molecular formula C11H17NO5S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-(2,3-dimethoxy-4-methylsulfonylphenyl)-N-methoxymethanamine.
| Compound Name | 1-(2,3-dimethoxy-4-methylsulfonylphenyl)-N-methoxymethanamine |
|---|---|
| PubChem CID | 117440327 |
| Molecular Formula | C11H17NO5S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 1-(2,3-dimethoxy-4-methylsulfonylphenyl)-N-methoxymethanamine |
| SMILES | CONCc1ccc(S(C)(=O)=O)c(OC)c1OC |
| InChI | InChI=1S/C11H17NO5S/c1-15-10-8(7-12-17-3)5-6-9(11(10)16-2)18(4,13)14/h5-6,12H,7H2,1-4H3 |
| InChIKey | OKRBLGLCWISEHW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|