C12H18O5S — CID 117438463
1-(2,3-dimethoxy-4-methylsulfonylphenyl)propan-2-ol (PubChem CID 117438463) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(2,3-dimethoxy-4-methylsulfonylphenyl)propan-2-ol.
| Compound Name | 1-(2,3-dimethoxy-4-methylsulfonylphenyl)propan-2-ol |
|---|---|
| PubChem CID | 117438463 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-(2,3-dimethoxy-4-methylsulfonylphenyl)propan-2-ol |
| SMILES | COc1c(CC(C)O)ccc(S(C)(=O)=O)c1OC |
| InChI | InChI=1S/C12H18O5S/c1-8(13)7-9-5-6-10(18(4,14)15)12(17-3)11(9)16-2/h5-6,8,13H,7H2,1-4H3 |
| InChIKey | DMFGRXYIXHPDLR-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |