C10H15NO5S — CID 117407158
N-[(2,5-dimethoxy-3-methylsulfonylphenyl)methyl]hydroxylamine (PubChem CID 117407158) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is N-[(2,5-dimethoxy-3-methylsulfonylphenyl)methyl]hydroxylamine.
| Compound Name | N-[(2,5-dimethoxy-3-methylsulfonylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117407158 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | N-[(2,5-dimethoxy-3-methylsulfonylphenyl)methyl]hydroxylamine |
| SMILES | COc1cc(CNO)c(OC)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C10H15NO5S/c1-15-8-4-7(6-11-12)10(16-2)9(5-8)17(3,13)14/h4-5,11-12H,6H2,1-3H3 |
| InChIKey | IHIHEEWSOZROJY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|