C8H9F2NO3S — CID 117346067
N-[(2,5-difluoro-4-methylsulfonylphenyl)methyl]hydroxylamine (PubChem CID 117346067) has the molecular formula C8H9F2NO3S and a molecular weight of 237.23 g/mol. Its IUPAC name is N-[(2,5-difluoro-4-methylsulfonylphenyl)methyl]hydroxylamine.
| Compound Name | N-[(2,5-difluoro-4-methylsulfonylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 117346067 |
| Molecular Formula | C8H9F2NO3S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | N-[(2,5-difluoro-4-methylsulfonylphenyl)methyl]hydroxylamine |
| SMILES | CS(=O)(=O)c1cc(F)c(CNO)cc1F |
| InChI | InChI=1S/C8H9F2NO3S/c1-15(13,14)8-3-6(9)5(4-11-12)2-7(8)10/h2-3,11-12H,4H2,1H3 |
| InChIKey | QTEOIKQVUHZIBE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|