C9H12FNO — CID 84765584
N-[(4-fluoro-2,5-dimethylphenyl)methyl]hydroxylamine (PubChem CID 84765584) has the molecular formula C9H12FNO and a molecular weight of 169.20 g/mol. Its IUPAC name is N-[(4-fluoro-2,5-dimethylphenyl)methyl]hydroxylamine.
| Compound Name | N-[(4-fluoro-2,5-dimethylphenyl)methyl]hydroxylamine |
|---|---|
| PubChem CID | 84765584 |
| Molecular Formula | C9H12FNO |
| Molecular Weight | 169.20 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-[(4-fluoro-2,5-dimethylphenyl)methyl]hydroxylamine |
| SMILES | Cc1cc(CNO)c(C)cc1F |
| InChI | InChI=1S/C9H12FNO/c1-6-4-9(10)7(2)3-8(6)5-11-12/h3-4,11-12H,5H2,1-2H3 |
| InChIKey | DQSPWVYNRMUGPX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|