About 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine
1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine (PubChem CID 79725175) has the molecular formula C9H11F2N
and a molecular weight of 171.19 g/mol. Its IUPAC name is 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine.
Analyze 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine?
The IUPAC name of 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine (CID 79725175) is 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine.
What is the SMILES notation for 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine?
The canonical SMILES for 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine is CNCc1cc(C)c(F)cc1F.
What is the InChIKey of 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine?
The InChIKey is BPILPWHRNGCHDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F2N/c1-6-3-7(5-12-2)9(11)4-8(6)10/h3-4,12H,5H2,1-2H3.
What are the key properties of 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine?
1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine has a molecular weight of 171.19 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluoro-5-methylphenyl)-N-methylmethanamine is sourced from PubChem (CID 79725175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).