C16H13F5 — CID 166874468
1-[2-(2,4-difluoro-5-methylphenyl)ethyl]-2,3,4-trifluoro-5-methylbenzene (PubChem CID 166874468) has the molecular formula C16H13F5 and a molecular weight of 300.27 g/mol. Its IUPAC name is 1-[2-(2,4-difluoro-5-methylphenyl)ethyl]-2,3,4-trifluoro-5-methylbenzene.
| Compound Name | 1-[2-(2,4-difluoro-5-methylphenyl)ethyl]-2,3,4-trifluoro-5-methylbenzene |
|---|---|
| PubChem CID | 166874468 |
| Molecular Formula | C16H13F5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 1-[2-(2,4-difluoro-5-methylphenyl)ethyl]-2,3,4-trifluoro-5-methylbenzene |
| SMILES | Cc1cc(CCc2cc(C)c(F)c(F)c2F)c(F)cc1F |
| InChI | InChI=1S/C16H13F5/c1-8-5-10(13(18)7-12(8)17)3-4-11-6-9(2)14(19)16(21)15(11)20/h5-7H,3-4H2,1-2H3 |
| InChIKey | QDRUCBBALGLWES-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|