C13H16F2O2 — CID 79731840
5-(2,4-difluoro-5-methylphenyl)-3-methylpentanoic acid (PubChem CID 79731840) has the molecular formula C13H16F2O2 and a molecular weight of 242.26 g/mol. Its IUPAC name is 5-(2,4-difluoro-5-methylphenyl)-3-methylpentanoic acid.
| Compound Name | 5-(2,4-difluoro-5-methylphenyl)-3-methylpentanoic acid |
|---|---|
| PubChem CID | 79731840 |
| Molecular Formula | C13H16F2O2 |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 5-(2,4-difluoro-5-methylphenyl)-3-methylpentanoic acid |
| SMILES | Cc1cc(CCC(C)CC(=O)O)c(F)cc1F |
| InChI | InChI=1S/C13H16F2O2/c1-8(5-13(16)17)3-4-10-6-9(2)11(14)7-12(10)15/h6-8H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | WEEQBTNVTZSSSE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |