C17H20O2 — CID 81432803
3-methyl-5-(2-methylnaphthalen-1-yl)pentanoic acid (PubChem CID 81432803) has the molecular formula C17H20O2 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-methyl-5-(2-methylnaphthalen-1-yl)pentanoic acid.
| Compound Name | 3-methyl-5-(2-methylnaphthalen-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 81432803 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-methyl-5-(2-methylnaphthalen-1-yl)pentanoic acid |
| SMILES | Cc1ccc2ccccc2c1CCC(C)CC(=O)O |
| InChI | InChI=1S/C17H20O2/c1-12(11-17(18)19)7-10-15-13(2)8-9-14-5-3-4-6-16(14)15/h3-6,8-9,12H,7,10-11H2,1-2H3,(H,18,19) |
| InChIKey | JBPLEVQZDQNAQE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |