C12H15ClFNO2 — CID 117042170
3-(2-chloro-5-fluoro-N,4-dimethylanilino)butanoic acid (PubChem CID 117042170) has the molecular formula C12H15ClFNO2 and a molecular weight of 259.71 g/mol. Its IUPAC name is 3-(2-chloro-5-fluoro-N,4-dimethylanilino)butanoic acid.
| Compound Name | 3-(2-chloro-5-fluoro-N,4-dimethylanilino)butanoic acid |
|---|---|
| PubChem CID | 117042170 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-(2-chloro-5-fluoro-N,4-dimethylanilino)butanoic acid |
| SMILES | Cc1cc(Cl)c(N(C)C(C)CC(=O)O)cc1F |
| InChI | InChI=1S/C12H15ClFNO2/c1-7-4-9(13)11(6-10(7)14)15(3)8(2)5-12(16)17/h4,6,8H,5H2,1-3H3,(H,16,17) |
| InChIKey | WLZLQZVRNZVTGF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |