C11H14ClFN2O2 — CID 116942886
3,4-diamino-4-(2-chloro-5-fluoro-4-methylphenyl)butanoic acid (PubChem CID 116942886) has the molecular formula C11H14ClFN2O2 and a molecular weight of 260.70 g/mol. Its IUPAC name is 3,4-diamino-4-(2-chloro-5-fluoro-4-methylphenyl)butanoic acid.
| Compound Name | 3,4-diamino-4-(2-chloro-5-fluoro-4-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 116942886 |
| Molecular Formula | C11H14ClFN2O2 |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 3,4-diamino-4-(2-chloro-5-fluoro-4-methylphenyl)butanoic acid |
| SMILES | Cc1cc(Cl)c(C(N)C(N)CC(=O)O)cc1F |
| InChI | InChI=1S/C11H14ClFN2O2/c1-5-2-7(12)6(3-8(5)13)11(15)9(14)4-10(16)17/h2-3,9,11H,4,14-15H2,1H3,(H,16,17) |
| InChIKey | JIHJRRHZXHYLQP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |