C12H17FN2O3 — CID 116942807
3,4-diamino-4-(4-ethoxy-3-fluorophenyl)butanoic acid (PubChem CID 116942807) has the molecular formula C12H17FN2O3 and a molecular weight of 256.28 g/mol. Its IUPAC name is 3,4-diamino-4-(4-ethoxy-3-fluorophenyl)butanoic acid.
| Compound Name | 3,4-diamino-4-(4-ethoxy-3-fluorophenyl)butanoic acid |
|---|---|
| PubChem CID | 116942807 |
| Molecular Formula | C12H17FN2O3 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3,4-diamino-4-(4-ethoxy-3-fluorophenyl)butanoic acid |
| SMILES | CCOc1ccc(C(N)C(N)CC(=O)O)cc1F |
| InChI | InChI=1S/C12H17FN2O3/c1-2-18-10-4-3-7(5-8(10)13)12(15)9(14)6-11(16)17/h3-5,9,12H,2,6,14-15H2,1H3,(H,16,17) |
| InChIKey | NHFGSCDMQIDZCD-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |