C13H17F2NO4 — CID 66097892
4-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]butanoic acid (PubChem CID 66097892) has the molecular formula C13H17F2NO4 and a molecular weight of 289.28 g/mol. Its IUPAC name is 4-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]butanoic acid.
| Compound Name | 4-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]butanoic acid |
|---|---|
| PubChem CID | 66097892 |
| Molecular Formula | C13H17F2NO4 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]butanoic acid |
| SMILES | CCOc1cc(C(CN)CC(=O)O)ccc1OC(F)F |
| InChI | InChI=1S/C13H17F2NO4/c1-2-19-11-5-8(9(7-16)6-12(17)18)3-4-10(11)20-13(14)15/h3-5,9,13H,2,6-7,16H2,1H3,(H,17,18) |
| InChIKey | AMYPXSAZQAQATE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |