C12H15F2NO4 — CID 21082339
3-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]propanoic acid (PubChem CID 21082339) has the molecular formula C12H15F2NO4 and a molecular weight of 275.25 g/mol. Its IUPAC name is 3-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]propanoic acid.
| Compound Name | 3-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 21082339 |
| Molecular Formula | C12H15F2NO4 |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | 3-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]propanoic acid |
| SMILES | CCOc1cc(C(N)CC(=O)O)ccc1OC(F)F |
| InChI | InChI=1S/C12H15F2NO4/c1-2-18-10-5-7(8(15)6-11(16)17)3-4-9(10)19-12(13)14/h3-5,8,12H,2,6,15H2,1H3,(H,16,17) |
| InChIKey | AYHNKXZRRIMPJW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |