C14H19F2NO4 — CID 66097877
methyl 4-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]butanoate (PubChem CID 66097877) has the molecular formula C14H19F2NO4 and a molecular weight of 303.31 g/mol. Its IUPAC name is methyl 4-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]butanoate.
| Compound Name | methyl 4-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]butanoate |
|---|---|
| PubChem CID | 66097877 |
| Molecular Formula | C14H19F2NO4 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | methyl 4-amino-3-[4-(difluoromethoxy)-3-ethoxyphenyl]butanoate |
| SMILES | CCOc1cc(C(CN)CC(=O)OC)ccc1OC(F)F |
| InChI | InChI=1S/C14H19F2NO4/c1-3-20-12-6-9(4-5-11(12)21-14(15)16)10(8-17)7-13(18)19-2/h4-6,10,14H,3,7-8,17H2,1-2H3 |
| InChIKey | WHMQGGZTPCJFLE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |