C14H22F2N2O3 — CID 62542549
1-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 62542549) has the molecular formula C14H22F2N2O3 and a molecular weight of 304.34 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(2-methoxyethyl)ethane-1,2-diamine.
| Compound Name | 1-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(2-methoxyethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62542549 |
| Molecular Formula | C14H22F2N2O3 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1-[4-(difluoromethoxy)-3-ethoxyphenyl]-N-(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | CCOc1cc(C(CN)NCCOC)ccc1OC(F)F |
| InChI | InChI=1S/C14H22F2N2O3/c1-3-20-13-8-10(4-5-12(13)21-14(15)16)11(9-17)18-6-7-19-2/h4-5,8,11,14,18H,3,6-7,9,17H2,1-2H3 |
| InChIKey | MGPILGRMQQPETP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|