C15H16F2N2O2 — CID 68547360
[4-(difluoromethoxy)-3-ethoxyphenyl]-pyridin-3-ylmethanamine (PubChem CID 68547360) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is [4-(difluoromethoxy)-3-ethoxyphenyl]-pyridin-3-ylmethanamine.
| Compound Name | [4-(difluoromethoxy)-3-ethoxyphenyl]-pyridin-3-ylmethanamine |
|---|---|
| PubChem CID | 68547360 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | [4-(difluoromethoxy)-3-ethoxyphenyl]-pyridin-3-ylmethanamine |
| SMILES | CCOc1cc(C(N)c2cccnc2)ccc1OC(F)F |
| InChI | InChI=1S/C15H16F2N2O2/c1-2-20-13-8-10(5-6-12(13)21-15(16)17)14(18)11-4-3-7-19-9-11/h3-9,14-15H,2,18H2,1H3 |
| InChIKey | AJSDPTCSHZKSQQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |