C13H16F2O3 — CID 79190781
1-[4-(difluoromethoxy)-3-ethoxyphenyl]-2-methylprop-2-en-1-ol (PubChem CID 79190781) has the molecular formula C13H16F2O3 and a molecular weight of 258.26 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)-3-ethoxyphenyl]-2-methylprop-2-en-1-ol.
| Compound Name | 1-[4-(difluoromethoxy)-3-ethoxyphenyl]-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 79190781 |
| Molecular Formula | C13H16F2O3 |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 1-[4-(difluoromethoxy)-3-ethoxyphenyl]-2-methylprop-2-en-1-ol |
| SMILES | C=C(C)C(O)c1ccc(OC(F)F)c(OCC)c1 |
| InChI | InChI=1S/C13H16F2O3/c1-4-17-11-7-9(12(16)8(2)3)5-6-10(11)18-13(14)15/h5-7,12-13,16H,2,4H2,1,3H3 |
| InChIKey | OPJVFKCBPCKPIW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|