C19H23ClF2O3 — CID 90215342
(1S,3E)-3-[(Z)-but-2-en-2-yl]-4-chloro-1-[4-(difluoromethoxy)-3-ethoxyphenyl]hexa-3,5-dien-1-ol (PubChem CID 90215342) has the molecular formula C19H23ClF2O3 and a molecular weight of 372.84 g/mol. Its IUPAC name is (1S,3E)-3-[(Z)-but-2-en-2-yl]-4-chloro-1-[4-(difluoromethoxy)-3-ethoxyphenyl]hexa-3,5-dien-1-ol.
| Compound Name | (1S,3E)-3-[(Z)-but-2-en-2-yl]-4-chloro-1-[4-(difluoromethoxy)-3-ethoxyphenyl]hexa-3,5-dien-1-ol |
|---|---|
| PubChem CID | 90215342 |
| Molecular Formula | C19H23ClF2O3 |
| Molecular Weight | 372.84 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (1S,3E)-3-[(Z)-but-2-en-2-yl]-4-chloro-1-[4-(difluoromethoxy)-3-ethoxyphenyl]hexa-3,5-dien-1-ol |
| SMILES | C=C/C(Cl)=C(C[C@H](O)c1ccc(OC(F)F)c(OCC)c1)\C(C)=C/C |
| InChI | InChI=1S/C19H23ClF2O3/c1-5-12(4)14(15(20)6-2)11-16(23)13-8-9-17(25-19(21)22)18(10-13)24-7-3/h5-6,8-10,16,19,23H,2,7,11H2,1,3-4H3/b12-5-,15-14+/t16-/m0/s1 |
| InChIKey | CTJSICODKLJKFB-GLDYDEFESA-N |
| XLogP | 5.76 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.84 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|