C19H19F2NO6 — CID 113235736
2-[4-(difluoromethoxy)-3-ethoxyphenyl]-2-(phenylmethoxycarbonylamino)acetic acid (PubChem CID 113235736) has the molecular formula C19H19F2NO6 and a molecular weight of 395.36 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)-3-ethoxyphenyl]-2-(phenylmethoxycarbonylamino)acetic acid.
| Compound Name | 2-[4-(difluoromethoxy)-3-ethoxyphenyl]-2-(phenylmethoxycarbonylamino)acetic acid |
|---|---|
| PubChem CID | 113235736 |
| Molecular Formula | C19H19F2NO6 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 2-[4-(difluoromethoxy)-3-ethoxyphenyl]-2-(phenylmethoxycarbonylamino)acetic acid |
| SMILES | CCOc1cc(C(NC(=O)OCc2ccccc2)C(=O)O)ccc1OC(F)F |
| InChI | InChI=1S/C19H19F2NO6/c1-2-26-15-10-13(8-9-14(15)28-18(20)21)16(17(23)24)22-19(25)27-11-12-6-4-3-5-7-12/h3-10,16,18H,2,11H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | VJFWKWNVUVTBQW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |