C15H21F2NO3 — CID 79126174
[1-(aminomethyl)cyclobutyl]-[4-(difluoromethoxy)-3-ethoxyphenyl]methanol (PubChem CID 79126174) has the molecular formula C15H21F2NO3 and a molecular weight of 301.33 g/mol. Its IUPAC name is [1-(aminomethyl)cyclobutyl]-[4-(difluoromethoxy)-3-ethoxyphenyl]methanol.
| Compound Name | [1-(aminomethyl)cyclobutyl]-[4-(difluoromethoxy)-3-ethoxyphenyl]methanol |
|---|---|
| PubChem CID | 79126174 |
| Molecular Formula | C15H21F2NO3 |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | [1-(aminomethyl)cyclobutyl]-[4-(difluoromethoxy)-3-ethoxyphenyl]methanol |
| SMILES | CCOc1cc(C(O)C2(CN)CCC2)ccc1OC(F)F |
| InChI | InChI=1S/C15H21F2NO3/c1-2-20-12-8-10(4-5-11(12)21-14(16)17)13(19)15(9-18)6-3-7-15/h4-5,8,13-14,19H,2-3,6-7,9,18H2,1H3 |
| InChIKey | JBMXFTLVZZDTOF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |