C16H24O4 — CID 103448377
1-[(3,4-diethoxyphenyl)-hydroxymethyl]cyclopentan-1-ol (PubChem CID 103448377) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-[(3,4-diethoxyphenyl)-hydroxymethyl]cyclopentan-1-ol.
| Compound Name | 1-[(3,4-diethoxyphenyl)-hydroxymethyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 103448377 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-[(3,4-diethoxyphenyl)-hydroxymethyl]cyclopentan-1-ol |
| SMILES | CCOc1ccc(C(O)C2(O)CCCC2)cc1OCC |
| InChI | InChI=1S/C16H24O4/c1-3-19-13-8-7-12(11-14(13)20-4-2)15(17)16(18)9-5-6-10-16/h7-8,11,15,17-18H,3-6,9-10H2,1-2H3 |
| InChIKey | QFXHQYZPEXUMFH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |