C16H24O4 — CID 62905165
(3,4-diethoxyphenyl)-(oxan-4-yl)methanol (PubChem CID 62905165) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-(oxan-4-yl)methanol.
| Compound Name | (3,4-diethoxyphenyl)-(oxan-4-yl)methanol |
|---|---|
| PubChem CID | 62905165 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | (3,4-diethoxyphenyl)-(oxan-4-yl)methanol |
| SMILES | CCOc1ccc(C(O)C2CCOCC2)cc1OCC |
| InChI | InChI=1S/C16H24O4/c1-3-19-14-6-5-13(11-15(14)20-4-2)16(17)12-7-9-18-10-8-12/h5-6,11-12,16-17H,3-4,7-10H2,1-2H3 |
| InChIKey | FIWAJQOMUNFNDJ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |